C12H16N4O2 — CID 166311017
2-cyclopropyl-6-[(3R)-3-hydroxypyrrolidin-1-yl]pyrimidine-4-carboxamide (PubChem CID 166311017) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-cyclopropyl-6-[(3R)-3-hydroxypyrrolidin-1-yl]pyrimidine-4-carboxamide.
| Compound Name | 2-cyclopropyl-6-[(3R)-3-hydroxypyrrolidin-1-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 166311017 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-cyclopropyl-6-[(3R)-3-hydroxypyrrolidin-1-yl]pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1cc(N2CC[C@@H](O)C2)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H16N4O2/c13-11(18)9-5-10(16-4-3-8(17)6-16)15-12(14-9)7-1-2-7/h5,7-8,17H,1-4,6H2,(H2,13,18)/t8-/m1/s1 |
| InChIKey | UPXHORUMEGGRLA-MRVPVSSYSA-N |
| XLogP | 0.02 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |