C11H12ClF2N3O2 — CID 166315197
N-(2-chloro-2,2-difluoroethyl)-N-methyl-2,3-dihydropyrido[4,3-b][1,4]oxazine-4-carboxamide (PubChem CID 166315197) has the molecular formula C11H12ClF2N3O2 and a molecular weight of 291.69 g/mol. Its IUPAC name is N-(2-chloro-2,2-difluoroethyl)-N-methyl-2,3-dihydropyrido[4,3-b][1,4]oxazine-4-carboxamide.
| Compound Name | N-(2-chloro-2,2-difluoroethyl)-N-methyl-2,3-dihydropyrido[4,3-b][1,4]oxazine-4-carboxamide |
|---|---|
| PubChem CID | 166315197 |
| Molecular Formula | C11H12ClF2N3O2 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | N-(2-chloro-2,2-difluoroethyl)-N-methyl-2,3-dihydropyrido[4,3-b][1,4]oxazine-4-carboxamide |
| SMILES | CN(CC(F)(F)Cl)C(=O)N1CCOc2ccncc21 |
| InChI | InChI=1S/C11H12ClF2N3O2/c1-16(7-11(12,13)14)10(18)17-4-5-19-9-2-3-15-6-8(9)17/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | JSRXOQLQJZDGBX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|