C9H5ClN2O2S — CID 166318533
2-chloro-4-(1,2,5-thiadiazol-3-yl)benzoic acid (PubChem CID 166318533) has the molecular formula C9H5ClN2O2S and a molecular weight of 240.67 g/mol. Its IUPAC name is 2-chloro-4-(1,2,5-thiadiazol-3-yl)benzoic acid.
| Compound Name | 2-chloro-4-(1,2,5-thiadiazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 166318533 |
| Molecular Formula | C9H5ClN2O2S |
| Molecular Weight | 240.67 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 2-chloro-4-(1,2,5-thiadiazol-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cnsn2)cc1Cl |
| InChI | InChI=1S/C9H5ClN2O2S/c10-7-3-5(8-4-11-15-12-8)1-2-6(7)9(13)14/h1-4H,(H,13,14) |
| InChIKey | JFCHYWWHIUDOOY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |