C20H21N5O — CID 166320542
3-(3-methylphenyl)-N-[(1R,3S)-3-(2H-tetrazol-5-yl)cyclopentyl]benzamide (PubChem CID 166320542) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-(3-methylphenyl)-N-[(1R,3S)-3-(2H-tetrazol-5-yl)cyclopentyl]benzamide.
| Compound Name | 3-(3-methylphenyl)-N-[(1R,3S)-3-(2H-tetrazol-5-yl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 166320542 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-(3-methylphenyl)-N-[(1R,3S)-3-(2H-tetrazol-5-yl)cyclopentyl]benzamide |
| SMILES | Cc1cccc(-c2cccc(C(=O)N[C@@H]3CC[C@H](c4nn[nH]n4)C3)c2)c1 |
| InChI | InChI=1S/C20H21N5O/c1-13-4-2-5-14(10-13)15-6-3-7-17(11-15)20(26)21-18-9-8-16(12-18)19-22-24-25-23-19/h2-7,10-11,16,18H,8-9,12H2,1H3,(H,21,26)(H,22,23,24,25)/t16-,18+/m0/s1 |
| InChIKey | YLRCFYRFMHJVKT-FUHWJXTLSA-N |
| XLogP | 3.24 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |