C17H18N6O3 — CID 166322482
5-hydroxy-N-[3-[(2H-triazole-4-carbonylamino)methyl]cyclobutyl]-1H-indole-2-carboxamide (PubChem CID 166322482) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 5-hydroxy-N-[3-[(2H-triazole-4-carbonylamino)methyl]cyclobutyl]-1H-indole-2-carboxamide.
| Compound Name | 5-hydroxy-N-[3-[(2H-triazole-4-carbonylamino)methyl]cyclobutyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166322482 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 5-hydroxy-N-[3-[(2H-triazole-4-carbonylamino)methyl]cyclobutyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCC1CC(NC(=O)c2cc3cc(O)ccc3[nH]2)C1)c1cn[nH]n1 |
| InChI | InChI=1S/C17H18N6O3/c24-12-1-2-13-10(5-12)6-14(21-13)17(26)20-11-3-9(4-11)7-18-16(25)15-8-19-23-22-15/h1-2,5-6,8-9,11,21,24H,3-4,7H2,(H,18,25)(H,20,26)(H,19,22,23) |
| InChIKey | CJGVIGBDKHDVEL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |