C19H30N2O4 — CID 166322531
1-[1-hydroxy-3-(oxolan-3-yl)propan-2-yl]-3-(4-hydroxy-2-phenylpentyl)urea (PubChem CID 166322531) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[1-hydroxy-3-(oxolan-3-yl)propan-2-yl]-3-(4-hydroxy-2-phenylpentyl)urea.
| Compound Name | 1-[1-hydroxy-3-(oxolan-3-yl)propan-2-yl]-3-(4-hydroxy-2-phenylpentyl)urea |
|---|---|
| PubChem CID | 166322531 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 1-[1-hydroxy-3-(oxolan-3-yl)propan-2-yl]-3-(4-hydroxy-2-phenylpentyl)urea |
| SMILES | CC(O)CC(CNC(=O)NC(CO)CC1CCOC1)c1ccccc1 |
| InChI | InChI=1S/C19H30N2O4/c1-14(23)9-17(16-5-3-2-4-6-16)11-20-19(24)21-18(12-22)10-15-7-8-25-13-15/h2-6,14-15,17-18,22-23H,7-13H2,1H3,(H2,20,21,24) |
| InChIKey | GJCAFOZNYUFTJE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |