C26H25NO5 — CID 166323103
4-(4-cyclopentyloxyphenyl)-2-[(4-methoxybenzoyl)amino]benzoic acid (PubChem CID 166323103) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 4-(4-cyclopentyloxyphenyl)-2-[(4-methoxybenzoyl)amino]benzoic acid.
| Compound Name | 4-(4-cyclopentyloxyphenyl)-2-[(4-methoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 166323103 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 4-(4-cyclopentyloxyphenyl)-2-[(4-methoxybenzoyl)amino]benzoic acid |
| SMILES | COc1ccc(C(=O)Nc2cc(-c3ccc(OC4CCCC4)cc3)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H25NO5/c1-31-20-11-8-18(9-12-20)25(28)27-24-16-19(10-15-23(24)26(29)30)17-6-13-22(14-7-17)32-21-4-2-3-5-21/h6-16,21H,2-5H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | UQLOSGYADUPVMU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |