C17H19F3N4O6S — CID 166323132
N-[(3-amino-5-methyl-1,2-oxazol-4-yl)sulfonyl]-2,3,4,5-tetrahydro-1H-2-benzazepine-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 166323132) has the molecular formula C17H19F3N4O6S and a molecular weight of 464.42 g/mol. Its IUPAC name is N-[(3-amino-5-methyl-1,2-oxazol-4-yl)sulfonyl]-2,3,4,5-tetrahydro-1H-2-benzazepine-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3-amino-5-methyl-1,2-oxazol-4-yl)sulfonyl]-2,3,4,5-tetrahydro-1H-2-benzazepine-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166323132 |
| Molecular Formula | C17H19F3N4O6S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-[(3-amino-5-methyl-1,2-oxazol-4-yl)sulfonyl]-2,3,4,5-tetrahydro-1H-2-benzazepine-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1onc(N)c1S(=O)(=O)NC(=O)c1ccc2c(c1)CCCNC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H18N4O4S.C2HF3O2/c1-9-13(14(16)18-23-9)24(21,22)19-15(20)11-4-5-12-8-17-6-2-3-10(12)7-11;3-2(4,5)1(6)7/h4-5,7,17H,2-3,6,8H2,1H3,(H2,16,18)(H,19,20);(H,6,7) |
| InChIKey | JDHFWVOEWRBUKQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 164.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |