C19H20N6O — CID 166323517
(4aR,7aS)-6-methyl-1-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 166323517) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is (4aR,7aS)-6-methyl-1-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aR,7aS)-6-methyl-1-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 166323517 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (4aR,7aS)-6-methyl-1-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | CN1C[C@@H]2[C@@H](CCCN2c2cc(-c3ccccc3)n3ncnc3n2)C1=O |
| InChI | InChI=1S/C19H20N6O/c1-23-11-16-14(18(23)26)8-5-9-24(16)17-10-15(13-6-3-2-4-7-13)25-19(22-17)20-12-21-25/h2-4,6-7,10,12,14,16H,5,8-9,11H2,1H3/t14-,16-/m1/s1 |
| InChIKey | JMBDKWIKKMULOZ-GDBMZVCRSA-N |
| XLogP | 1.85 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |