C10H8F3N3O — CID 166323719
N-(2,2-difluoroethyl)-6-fluoro-1H-benzimidazole-5-carboxamide (PubChem CID 166323719) has the molecular formula C10H8F3N3O and a molecular weight of 243.19 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-6-fluoro-1H-benzimidazole-5-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-6-fluoro-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 166323719 |
| Molecular Formula | C10H8F3N3O |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-(2,2-difluoroethyl)-6-fluoro-1H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCC(F)F)c1cc2nc[nH]c2cc1F |
| InChI | InChI=1S/C10H8F3N3O/c11-6-2-8-7(15-4-16-8)1-5(6)10(17)14-3-9(12)13/h1-2,4,9H,3H2,(H,14,17)(H,15,16) |
| InChIKey | JTNMZAJUCGJQMO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |