C19H16O3S — CID 166325213
7-[4-(1-hydroxycyclobutyl)phenyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 166325213) has the molecular formula C19H16O3S and a molecular weight of 324.40 g/mol. Its IUPAC name is 7-[4-(1-hydroxycyclobutyl)phenyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 7-[4-(1-hydroxycyclobutyl)phenyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 166325213 |
| Molecular Formula | C19H16O3S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 7-[4-(1-hydroxycyclobutyl)phenyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cccc(-c3ccc(C4(O)CCC4)cc3)c2s1 |
| InChI | InChI=1S/C19H16O3S/c20-18(21)16-11-13-3-1-4-15(17(13)23-16)12-5-7-14(8-6-12)19(22)9-2-10-19/h1,3-8,11,22H,2,9-10H2,(H,20,21) |
| InChIKey | LZUYQUPYYPWHDU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |