C23H27F3N4O5 — CID 166325665
1-[4-[1-(3-cyclobutyloxypropyl)triazol-4-yl]-2-methoxybenzoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 166325665) has the molecular formula C23H27F3N4O5 and a molecular weight of 496.49 g/mol. Its IUPAC name is 1-[4-[1-(3-cyclobutyloxypropyl)triazol-4-yl]-2-methoxybenzoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-[1-(3-cyclobutyloxypropyl)triazol-4-yl]-2-methoxybenzoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166325665 |
| Molecular Formula | C23H27F3N4O5 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 1-[4-[1-(3-cyclobutyloxypropyl)triazol-4-yl]-2-methoxybenzoyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1cc(-c2cn(CCCOC3CCC3)nn2)ccc1C(=O)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C23H27F3N4O5/c1-34-19-12-15(18-13-30(28-27-18)9-3-11-35-16-4-2-5-16)6-7-17(19)20(31)29-10-8-22(14-29,21(32)33)23(24,25)26/h6-7,12-13,16H,2-5,8-11,14H2,1H3,(H,32,33) |
| InChIKey | KMHUJBYWXZSTPI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|