C24H33ClFN5O3 — CID 166325758
2-[1-[7-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-7-oxoheptyl]triazol-4-yl]-2-methylpropanoic acid (PubChem CID 166325758) has the molecular formula C24H33ClFN5O3 and a molecular weight of 494.01 g/mol. Its IUPAC name is 2-[1-[7-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-7-oxoheptyl]triazol-4-yl]-2-methylpropanoic acid.
| Compound Name | 2-[1-[7-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-7-oxoheptyl]triazol-4-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 166325758 |
| Molecular Formula | C24H33ClFN5O3 |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 2-[1-[7-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-7-oxoheptyl]triazol-4-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1cn(CCCCCCC(=O)N2CCN(Cc3ccc(F)cc3Cl)CC2)nn1 |
| InChI | InChI=1S/C24H33ClFN5O3/c1-24(2,23(33)34)21-17-31(28-27-21)10-6-4-3-5-7-22(32)30-13-11-29(12-14-30)16-18-8-9-19(26)15-20(18)25/h8-9,15,17H,3-7,10-14,16H2,1-2H3,(H,33,34) |
| InChIKey | UYYBOCCGFUARGW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|