C31H25ClN2O7S2 — CID 16632583
ethyl 4-[3-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 16632583) has the molecular formula C31H25ClN2O7S2 and a molecular weight of 637.14 g/mol. Its IUPAC name is ethyl 4-[3-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 16632583 |
| Molecular Formula | C31H25ClN2O7S2 |
| Molecular Weight | 637.14 g/mol |
| Exact Mass | 636.08 |
| IUPAC Name | ethyl 4-[3-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N3C(=O)/C(=C/c4ccc(OCc5ccc(Cl)cc5)c(OC)c4)SC3=S)C2=O)cc1 |
| InChI | InChI=1S/C31H25ClN2O7S2/c1-3-40-30(38)20-7-11-22(12-8-20)33-27(35)16-23(28(33)36)34-29(37)26(43-31(34)42)15-19-6-13-24(25(14-19)39-2)41-17-18-4-9-21(32)10-5-18/h4-15,23H,3,16-17H2,1-2H3/b26-15- |
| InChIKey | WJAUIGJNROTHKB-YSMPRRRNSA-N |
| XLogP | 5.64 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.14 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|