C20H12Cl2N2O3S2 — CID 5293532
1-(4-chlorophenyl)-3-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione (PubChem CID 5293532) has the molecular formula C20H12Cl2N2O3S2 and a molecular weight of 463.37 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-3-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5293532 |
| Molecular Formula | C20H12Cl2N2O3S2 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2C(=O)/C(=C/c3ccc(Cl)cc3)SC2=S)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12Cl2N2O3S2/c21-12-3-1-11(2-4-12)9-16-19(27)24(20(28)29-16)15-10-17(25)23(18(15)26)14-7-5-13(22)6-8-14/h1-9,15H,10H2/b16-9- |
| InChIKey | QDZYAHHBKWDCSG-SXGWCWSVSA-N |
| XLogP | 4.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|