C24H20N2O4S2 — CID 6384219
1-(4-ethoxyphenyl)-3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione (PubChem CID 6384219) has the molecular formula C24H20N2O4S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(4-ethoxyphenyl)-3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6384219 |
| Molecular Formula | C24H20N2O4S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)CC(N3C(=O)/C(=C/C=C/c4ccccc4)SC3=S)C2=O)cc1 |
| InChI | InChI=1S/C24H20N2O4S2/c1-2-30-18-13-11-17(12-14-18)25-21(27)15-19(22(25)28)26-23(29)20(32-24(26)31)10-6-9-16-7-4-3-5-8-16/h3-14,19H,2,15H2,1H3/b9-6+,20-10- |
| InChIKey | PMBQIUAEBAZCNB-CRVGVPJFSA-N |
| XLogP | 4.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|