C21H13FN2O5S2 — CID 16632508
4-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 16632508) has the molecular formula C21H13FN2O5S2 and a molecular weight of 456.48 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 16632508 |
| Molecular Formula | C21H13FN2O5S2 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 4-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)CC(N3C(=O)/C(=C/c4ccc(F)cc4)SC3=S)C2=O)cc1 |
| InChI | InChI=1S/C21H13FN2O5S2/c22-13-5-1-11(2-6-13)9-16-19(27)24(21(30)31-16)15-10-17(25)23(18(15)26)14-7-3-12(4-8-14)20(28)29/h1-9,15H,10H2,(H,28,29)/b16-9- |
| InChIKey | CZHJMOYBNJCFEJ-SXGWCWSVSA-N |
| XLogP | 3.06 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|