C23H17ClN2O6S — CID 98145217
ethyl 4-[(3S)-3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 98145217) has the molecular formula C23H17ClN2O6S and a molecular weight of 484.92 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 98145217 |
| Molecular Formula | C23H17ClN2O6S |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | ethyl 4-[(3S)-3-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H](N3C(=O)S/C(=C\c4ccc(Cl)cc4)C3=O)C2=O)cc1 |
| InChI | InChI=1S/C23H17ClN2O6S/c1-2-32-22(30)14-5-9-16(10-6-14)25-19(27)12-17(20(25)28)26-21(29)18(33-23(26)31)11-13-3-7-15(24)8-4-13/h3-11,17H,2,12H2,1H3/b18-11-/t17-/m0/s1 |
| InChIKey | NSSMNSZVGPFDQT-PBXDPIQXSA-N |
| XLogP | 3.89 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|