C16H21NO5S — CID 166331975
3-(oxolan-3-yl)-2-[(2-phenylcyclopropyl)sulfonylamino]propanoic acid (PubChem CID 166331975) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-2-[(2-phenylcyclopropyl)sulfonylamino]propanoic acid.
| Compound Name | 3-(oxolan-3-yl)-2-[(2-phenylcyclopropyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 166331975 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3-(oxolan-3-yl)-2-[(2-phenylcyclopropyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)C(CC1CCOC1)NS(=O)(=O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C16H21NO5S/c18-16(19)14(8-11-6-7-22-10-11)17-23(20,21)15-9-13(15)12-4-2-1-3-5-12/h1-5,11,13-15,17H,6-10H2,(H,18,19) |
| InChIKey | NBVLCVGFQCTFAQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |