C14H16F3NO6S — CID 170430238
(2S)-3-[(3S)-oxolan-3-yl]-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoic acid (PubChem CID 170430238) has the molecular formula C14H16F3NO6S and a molecular weight of 383.34 g/mol. Its IUPAC name is (2S)-3-[(3S)-oxolan-3-yl]-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[(3S)-oxolan-3-yl]-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 170430238 |
| Molecular Formula | C14H16F3NO6S |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (2S)-3-[(3S)-oxolan-3-yl]-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)[C@H](C[C@H]1CCOC1)NS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3NO6S/c15-14(16,17)24-10-1-3-11(4-2-10)25(21,22)18-12(13(19)20)7-9-5-6-23-8-9/h1-4,9,12,18H,5-8H2,(H,19,20)/t9-,12+/m1/s1 |
| InChIKey | UATIBKFWUKLVAB-SKDRFNHKSA-N |
| XLogP | 1.74 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |