C12H14F3NO5S2 — CID 167898154
3-(oxolan-3-yl)-2-[[5-(trifluoromethyl)thiophen-2-yl]sulfonylamino]propanoic acid (PubChem CID 167898154) has the molecular formula C12H14F3NO5S2 and a molecular weight of 373.37 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-2-[[5-(trifluoromethyl)thiophen-2-yl]sulfonylamino]propanoic acid.
| Compound Name | 3-(oxolan-3-yl)-2-[[5-(trifluoromethyl)thiophen-2-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 167898154 |
| Molecular Formula | C12H14F3NO5S2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 3-(oxolan-3-yl)-2-[[5-(trifluoromethyl)thiophen-2-yl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)C(CC1CCOC1)NS(=O)(=O)c1ccc(C(F)(F)F)s1 |
| InChI | InChI=1S/C12H14F3NO5S2/c13-12(14,15)9-1-2-10(22-9)23(19,20)16-8(11(17)18)5-7-3-4-21-6-7/h1-2,7-8,16H,3-6H2,(H,17,18) |
| InChIKey | VIDYJGBPAUTJBO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |