C23H22Cl2N4O2 — CID 166332599
N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-(1-methyl-3-phenylpyrazol-4-yl)oxamide (PubChem CID 166332599) has the molecular formula C23H22Cl2N4O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-(1-methyl-3-phenylpyrazol-4-yl)oxamide.
| Compound Name | N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-(1-methyl-3-phenylpyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 166332599 |
| Molecular Formula | C23H22Cl2N4O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-(1-methyl-3-phenylpyrazol-4-yl)oxamide |
| SMILES | Cn1cc(NC(=O)C(=O)NC2(Cc3ccc(Cl)cc3Cl)CCC2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H22Cl2N4O2/c1-29-14-19(20(28-29)15-6-3-2-4-7-15)26-21(30)22(31)27-23(10-5-11-23)13-16-8-9-17(24)12-18(16)25/h2-4,6-9,12,14H,5,10-11,13H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | IKHOZQGTDDFFJD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|