C21H22Cl2N4O3 — CID 166332692
N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-[2-(dimethylcarbamoyl)-4-pyridinyl]oxamide (PubChem CID 166332692) has the molecular formula C21H22Cl2N4O3 and a molecular weight of 449.34 g/mol. Its IUPAC name is N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-[2-(dimethylcarbamoyl)-4-pyridinyl]oxamide.
| Compound Name | N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-[2-(dimethylcarbamoyl)-4-pyridinyl]oxamide |
|---|---|
| PubChem CID | 166332692 |
| Molecular Formula | C21H22Cl2N4O3 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-[2-(dimethylcarbamoyl)-4-pyridinyl]oxamide |
| SMILES | CN(C)C(=O)c1cc(NC(=O)C(=O)NC2(Cc3ccc(Cl)cc3Cl)CCC2)ccn1 |
| InChI | InChI=1S/C21H22Cl2N4O3/c1-27(2)20(30)17-11-15(6-9-24-17)25-18(28)19(29)26-21(7-3-8-21)12-13-4-5-14(22)10-16(13)23/h4-6,9-11H,3,7-8,12H2,1-2H3,(H,26,29)(H,24,25,28) |
| InChIKey | MTQMWUCQQZZNMB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|