C20H22Cl2N4O4S — CID 167981612
N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-[2-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]oxamide (PubChem CID 167981612) has the molecular formula C20H22Cl2N4O4S and a molecular weight of 485.39 g/mol. Its IUPAC name is N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-[2-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]oxamide.
| Compound Name | N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-[2-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 167981612 |
| Molecular Formula | C20H22Cl2N4O4S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | N'-[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]-N-[2-(1,1-dioxothiolan-3-yl)pyrazol-3-yl]oxamide |
| SMILES | O=C(Nc1ccnn1C1CCS(=O)(=O)C1)C(=O)NC1(Cc2ccc(Cl)cc2Cl)CCC1 |
| InChI | InChI=1S/C20H22Cl2N4O4S/c21-14-3-2-13(16(22)10-14)11-20(6-1-7-20)25-19(28)18(27)24-17-4-8-23-26(17)15-5-9-31(29,30)12-15/h2-4,8,10,15H,1,5-7,9,11-12H2,(H,24,27)(H,25,28) |
| InChIKey | RRNKCWWNQUJCNK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|