C20H23Cl2N3O2S — CID 166332630
N-[4-[[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]amino]-4-oxobutyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 166332630) has the molecular formula C20H23Cl2N3O2S and a molecular weight of 440.40 g/mol. Its IUPAC name is N-[4-[[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]amino]-4-oxobutyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-[[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]amino]-4-oxobutyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 166332630 |
| Molecular Formula | C20H23Cl2N3O2S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[4-[[1-[(2,4-dichlorophenyl)methyl]cyclobutyl]amino]-4-oxobutyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NCCCC(=O)NC1(Cc2ccc(Cl)cc2Cl)CCC1 |
| InChI | InChI=1S/C20H23Cl2N3O2S/c1-13-18(28-12-24-13)19(27)23-9-2-4-17(26)25-20(7-3-8-20)11-14-5-6-15(21)10-16(14)22/h5-6,10,12H,2-4,7-9,11H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | MFHMCGASVTWUQU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|