C19H14ClF3N2O4S — CID 166333578
N-(6-chloroquinolin-8-yl)sulfonyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]acetamide (PubChem CID 166333578) has the molecular formula C19H14ClF3N2O4S and a molecular weight of 458.85 g/mol. Its IUPAC name is N-(6-chloroquinolin-8-yl)sulfonyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]acetamide.
| Compound Name | N-(6-chloroquinolin-8-yl)sulfonyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 166333578 |
| Molecular Formula | C19H14ClF3N2O4S |
| Molecular Weight | 458.85 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | N-(6-chloroquinolin-8-yl)sulfonyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OCC(F)(F)F)cc1)NS(=O)(=O)c1cc(Cl)cc2cccnc12 |
| InChI | InChI=1S/C19H14ClF3N2O4S/c20-14-9-13-2-1-7-24-18(13)16(10-14)30(27,28)25-17(26)8-12-3-5-15(6-4-12)29-11-19(21,22)23/h1-7,9-10H,8,11H2,(H,25,26) |
| InChIKey | JUNBYKXUORUUNP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |