C23H25ClN2O3S — CID 167952759
2-(4-tert-butylphenyl)-N-(6-chloroquinolin-8-yl)sulfonyl-2-methylpropanamide (PubChem CID 167952759) has the molecular formula C23H25ClN2O3S and a molecular weight of 444.98 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-(6-chloroquinolin-8-yl)sulfonyl-2-methylpropanamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-(6-chloroquinolin-8-yl)sulfonyl-2-methylpropanamide |
|---|---|
| PubChem CID | 167952759 |
| Molecular Formula | C23H25ClN2O3S |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-(6-chloroquinolin-8-yl)sulfonyl-2-methylpropanamide |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C(=O)NS(=O)(=O)c2cc(Cl)cc3cccnc23)cc1 |
| InChI | InChI=1S/C23H25ClN2O3S/c1-22(2,3)16-8-10-17(11-9-16)23(4,5)21(27)26-30(28,29)19-14-18(24)13-15-7-6-12-25-20(15)19/h6-14H,1-5H3,(H,26,27) |
| InChIKey | QPUVWMLKSWSOTI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |