C17H15BrFNO4 — CID 166333803
4-[[[2-(3-bromo-4-fluorophenyl)-2-hydroxypropanoyl]amino]methyl]benzoic acid (PubChem CID 166333803) has the molecular formula C17H15BrFNO4 and a molecular weight of 396.21 g/mol. Its IUPAC name is 4-[[[2-(3-bromo-4-fluorophenyl)-2-hydroxypropanoyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(3-bromo-4-fluorophenyl)-2-hydroxypropanoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 166333803 |
| Molecular Formula | C17H15BrFNO4 |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | 4-[[[2-(3-bromo-4-fluorophenyl)-2-hydroxypropanoyl]amino]methyl]benzoic acid |
| SMILES | CC(O)(C(=O)NCc1ccc(C(=O)O)cc1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C17H15BrFNO4/c1-17(24,12-6-7-14(19)13(18)8-12)16(23)20-9-10-2-4-11(5-3-10)15(21)22/h2-8,24H,9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | AUFZSJNTKSLSMN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |