C12H11BrFNO2 — CID 55211983
2-(3-bromo-4-fluorophenyl)-2-(prop-2-ynylamino)propanoic acid (PubChem CID 55211983) has the molecular formula C12H11BrFNO2 and a molecular weight of 300.13 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-2-(prop-2-ynylamino)propanoic acid.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-2-(prop-2-ynylamino)propanoic acid |
|---|---|
| PubChem CID | 55211983 |
| Molecular Formula | C12H11BrFNO2 |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-2-(prop-2-ynylamino)propanoic acid |
| SMILES | C#CCNC(C)(C(=O)O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H11BrFNO2/c1-3-6-15-12(2,11(16)17)8-4-5-10(14)9(13)7-8/h1,4-5,7,15H,6H2,2H3,(H,16,17) |
| InChIKey | PPPVKUQDRLIGNT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|