C15H16INO3S2 — CID 166338488
N-[2-(3,4-dihydro-1H-isochromen-6-yl)ethyl]-3-iodothiophene-2-sulfonamide (PubChem CID 166338488) has the molecular formula C15H16INO3S2 and a molecular weight of 449.34 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isochromen-6-yl)ethyl]-3-iodothiophene-2-sulfonamide.
| Compound Name | N-[2-(3,4-dihydro-1H-isochromen-6-yl)ethyl]-3-iodothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166338488 |
| Molecular Formula | C15H16INO3S2 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.96 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isochromen-6-yl)ethyl]-3-iodothiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc2c(c1)CCOC2)c1sccc1I |
| InChI | InChI=1S/C15H16INO3S2/c16-14-5-8-21-15(14)22(18,19)17-6-3-11-1-2-13-10-20-7-4-12(13)9-11/h1-2,5,8-9,17H,3-4,6-7,10H2 |
| InChIKey | VWDUGSPCCWBXQU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|