C15H15BrN4S — CID 166341916
N-(2,1,3-benzothiadiazol-5-ylmethyl)-2-(6-bromo-3-pyridinyl)propan-2-amine (PubChem CID 166341916) has the molecular formula C15H15BrN4S and a molecular weight of 363.28 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-5-ylmethyl)-2-(6-bromo-3-pyridinyl)propan-2-amine.
| Compound Name | N-(2,1,3-benzothiadiazol-5-ylmethyl)-2-(6-bromo-3-pyridinyl)propan-2-amine |
|---|---|
| PubChem CID | 166341916 |
| Molecular Formula | C15H15BrN4S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-5-ylmethyl)-2-(6-bromo-3-pyridinyl)propan-2-amine |
| SMILES | CC(C)(NCc1ccc2nsnc2c1)c1ccc(Br)nc1 |
| InChI | InChI=1S/C15H15BrN4S/c1-15(2,11-4-6-14(16)17-9-11)18-8-10-3-5-12-13(7-10)20-21-19-12/h3-7,9,18H,8H2,1-2H3 |
| InChIKey | BUGLKWQXTFCMKJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|