C17H19F5N4O3S — CID 166342468
N-[3-[4-[[3-(difluoromethyl)-1,5-dimethylpyrazol-4-yl]sulfamoyl]phenyl]propyl]-2,2,2-trifluoroacetamide (PubChem CID 166342468) has the molecular formula C17H19F5N4O3S and a molecular weight of 454.42 g/mol. Its IUPAC name is N-[3-[4-[[3-(difluoromethyl)-1,5-dimethylpyrazol-4-yl]sulfamoyl]phenyl]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[4-[[3-(difluoromethyl)-1,5-dimethylpyrazol-4-yl]sulfamoyl]phenyl]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 166342468 |
| Molecular Formula | C17H19F5N4O3S |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[3-[4-[[3-(difluoromethyl)-1,5-dimethylpyrazol-4-yl]sulfamoyl]phenyl]propyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1c(NS(=O)(=O)c2ccc(CCCNC(=O)C(F)(F)F)cc2)c(C(F)F)nn1C |
| InChI | InChI=1S/C17H19F5N4O3S/c1-10-13(14(15(18)19)24-26(10)2)25-30(28,29)12-7-5-11(6-8-12)4-3-9-23-16(27)17(20,21)22/h5-8,15,25H,3-4,9H2,1-2H3,(H,23,27) |
| InChIKey | GFOKSASJAHIOCO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|