C23H30N4O3S — CID 166342929
3-[1-[2-(2-methylpropylamino)-5-morpholin-4-ylsulfonylanilino]ethyl]benzonitrile (PubChem CID 166342929) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 3-[1-[2-(2-methylpropylamino)-5-morpholin-4-ylsulfonylanilino]ethyl]benzonitrile.
| Compound Name | 3-[1-[2-(2-methylpropylamino)-5-morpholin-4-ylsulfonylanilino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 166342929 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 3-[1-[2-(2-methylpropylamino)-5-morpholin-4-ylsulfonylanilino]ethyl]benzonitrile |
| SMILES | CC(C)CNc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C23H30N4O3S/c1-17(2)16-25-22-8-7-21(31(28,29)27-9-11-30-12-10-27)14-23(22)26-18(3)20-6-4-5-19(13-20)15-24/h4-8,13-14,17-18,25-26H,9-12,16H2,1-3H3 |
| InChIKey | POUVNEXQVRNELC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |