C21H20Cl2N4O3 — CID 166343402
N-[(5-chloro-2-methoxyphenyl)-(3-chlorophenyl)methyl]-3-(4-nitropyrazol-1-yl)cyclobutan-1-amine (PubChem CID 166343402) has the molecular formula C21H20Cl2N4O3 and a molecular weight of 447.32 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)-(3-chlorophenyl)methyl]-3-(4-nitropyrazol-1-yl)cyclobutan-1-amine.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)-(3-chlorophenyl)methyl]-3-(4-nitropyrazol-1-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 166343402 |
| Molecular Formula | C21H20Cl2N4O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)-(3-chlorophenyl)methyl]-3-(4-nitropyrazol-1-yl)cyclobutan-1-amine |
| SMILES | COc1ccc(Cl)cc1C(NC1CC(n2cc([N+](=O)[O-])cn2)C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H20Cl2N4O3/c1-30-20-6-5-15(23)8-19(20)21(13-3-2-4-14(22)7-13)25-16-9-17(10-16)26-12-18(11-24-26)27(28)29/h2-8,11-12,16-17,21,25H,9-10H2,1H3 |
| InChIKey | VJMVUEKTHUHPCG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|