C26H27Br2N3O3S — CID 166346340
N-[2-[(4-benzylpiperazin-1-yl)methyl]-5-bromophenyl]-2-bromo-5-methylsulfonylbenzamide (PubChem CID 166346340) has the molecular formula C26H27Br2N3O3S and a molecular weight of 621.40 g/mol. Its IUPAC name is N-[2-[(4-benzylpiperazin-1-yl)methyl]-5-bromophenyl]-2-bromo-5-methylsulfonylbenzamide.
| Compound Name | N-[2-[(4-benzylpiperazin-1-yl)methyl]-5-bromophenyl]-2-bromo-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 166346340 |
| Molecular Formula | C26H27Br2N3O3S |
| Molecular Weight | 621.40 g/mol |
| Exact Mass | 619.01 |
| IUPAC Name | N-[2-[(4-benzylpiperazin-1-yl)methyl]-5-bromophenyl]-2-bromo-5-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(Br)c(C(=O)Nc2cc(Br)ccc2CN2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H27Br2N3O3S/c1-35(33,34)22-9-10-24(28)23(16-22)26(32)29-25-15-21(27)8-7-20(25)18-31-13-11-30(12-14-31)17-19-5-3-2-4-6-19/h2-10,15-16H,11-14,17-18H2,1H3,(H,29,32) |
| InChIKey | QCOIKWIRMJFOIY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |