C33H31BrN4O — CID 166401452
N-[2-[(4-benzylpiperazin-1-yl)methyl]-5-bromophenyl]-4-indol-1-ylbenzamide (PubChem CID 166401452) has the molecular formula C33H31BrN4O and a molecular weight of 579.54 g/mol. Its IUPAC name is N-[2-[(4-benzylpiperazin-1-yl)methyl]-5-bromophenyl]-4-indol-1-ylbenzamide.
| Compound Name | N-[2-[(4-benzylpiperazin-1-yl)methyl]-5-bromophenyl]-4-indol-1-ylbenzamide |
|---|---|
| PubChem CID | 166401452 |
| Molecular Formula | C33H31BrN4O |
| Molecular Weight | 579.54 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | N-[2-[(4-benzylpiperazin-1-yl)methyl]-5-bromophenyl]-4-indol-1-ylbenzamide |
| SMILES | O=C(Nc1cc(Br)ccc1CN1CCN(Cc2ccccc2)CC1)c1ccc(-n2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C33H31BrN4O/c34-29-13-10-28(24-37-20-18-36(19-21-37)23-25-6-2-1-3-7-25)31(22-29)35-33(39)27-11-14-30(15-12-27)38-17-16-26-8-4-5-9-32(26)38/h1-17,22H,18-21,23-24H2,(H,35,39) |
| InChIKey | FCGDEQRFLPRZJG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.54 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |