C30H34BrN3O4S — CID 166347847
N-benzyl-N-[(4-bromophenyl)methyl]-2-oxo-2-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 166347847) has the molecular formula C30H34BrN3O4S and a molecular weight of 612.59 g/mol. Its IUPAC name is N-benzyl-N-[(4-bromophenyl)methyl]-2-oxo-2-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-benzyl-N-[(4-bromophenyl)methyl]-2-oxo-2-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 166347847 |
| Molecular Formula | C30H34BrN3O4S |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | N-benzyl-N-[(4-bromophenyl)methyl]-2-oxo-2-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(C(=O)C(=O)N(Cc3ccccc3)Cc3ccc(Br)cc3)CC2)c1C |
| InChI | InChI=1S/C30H34BrN3O4S/c1-21-18-22(2)24(4)28(23(21)3)39(37,38)34-16-14-32(15-17-34)29(35)30(36)33(19-25-8-6-5-7-9-25)20-26-10-12-27(31)13-11-26/h5-13,18H,14-17,19-20H2,1-4H3 |
| InChIKey | QMZRARBTSGHAQW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|