C28H26Br2N2O4 — CID 166354657
methyl 1-[2-[benzyl-[(4-bromophenyl)methyl]amino]-2-oxoacetyl]-3-(3-bromophenyl)pyrrolidine-3-carboxylate (PubChem CID 166354657) has the molecular formula C28H26Br2N2O4 and a molecular weight of 614.33 g/mol. Its IUPAC name is methyl 1-[2-[benzyl-[(4-bromophenyl)methyl]amino]-2-oxoacetyl]-3-(3-bromophenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[2-[benzyl-[(4-bromophenyl)methyl]amino]-2-oxoacetyl]-3-(3-bromophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 166354657 |
| Molecular Formula | C28H26Br2N2O4 |
| Molecular Weight | 614.33 g/mol |
| Exact Mass | 612.03 |
| IUPAC Name | methyl 1-[2-[benzyl-[(4-bromophenyl)methyl]amino]-2-oxoacetyl]-3-(3-bromophenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1(c2cccc(Br)c2)CCN(C(=O)C(=O)N(Cc2ccccc2)Cc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C28H26Br2N2O4/c1-36-27(35)28(22-8-5-9-24(30)16-22)14-15-31(19-28)25(33)26(34)32(17-20-6-3-2-4-7-20)18-21-10-12-23(29)13-11-21/h2-13,16H,14-15,17-19H2,1H3 |
| InChIKey | RLCWIFIUJYZXGX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|