C23H21BrFN3O7S2 — CID 166348499
3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)-N-(2-fluoro-4-nitrophenyl)sulfonylpropanamide (PubChem CID 166348499) has the molecular formula C23H21BrFN3O7S2 and a molecular weight of 614.47 g/mol. Its IUPAC name is 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)-N-(2-fluoro-4-nitrophenyl)sulfonylpropanamide.
| Compound Name | 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)-N-(2-fluoro-4-nitrophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 166348499 |
| Molecular Formula | C23H21BrFN3O7S2 |
| Molecular Weight | 614.47 g/mol |
| Exact Mass | 613.00 |
| IUPAC Name | 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)-N-(2-fluoro-4-nitrophenyl)sulfonylpropanamide |
| SMILES | Cc1cc(C)cc(N(CCC(=O)NS(=O)(=O)c2ccc([N+](=O)[O-])cc2F)S(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C23H21BrFN3O7S2/c1-15-11-16(2)13-19(12-15)27(37(34,35)20-6-3-17(24)4-7-20)10-9-23(29)26-36(32,33)22-8-5-18(28(30)31)14-21(22)25/h3-8,11-14H,9-10H2,1-2H3,(H,26,29) |
| InChIKey | SBXQBHGFBQMACC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|