C19H19BrN2O4S — CID 42972695
cyanomethyl 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)propanoate (PubChem CID 42972695) has the molecular formula C19H19BrN2O4S and a molecular weight of 451.34 g/mol. Its IUPAC name is cyanomethyl 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)propanoate.
| Compound Name | cyanomethyl 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 42972695 |
| Molecular Formula | C19H19BrN2O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | cyanomethyl 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)propanoate |
| SMILES | Cc1cc(C)cc(N(CCC(=O)OCC#N)S(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C19H19BrN2O4S/c1-14-11-15(2)13-17(12-14)22(9-7-19(23)26-10-8-21)27(24,25)18-5-3-16(20)4-6-18/h3-6,11-13H,7,9-10H2,1-2H3 |
| InChIKey | BNKSRHOAVPSRMU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |