C26H23Br2NO4S — CID 166345872
(3-bromo-5-ethynylphenyl)methyl 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)propanoate (PubChem CID 166345872) has the molecular formula C26H23Br2NO4S and a molecular weight of 605.35 g/mol. Its IUPAC name is (3-bromo-5-ethynylphenyl)methyl 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)propanoate.
| Compound Name | (3-bromo-5-ethynylphenyl)methyl 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 166345872 |
| Molecular Formula | C26H23Br2NO4S |
| Molecular Weight | 605.35 g/mol |
| Exact Mass | 602.97 |
| IUPAC Name | (3-bromo-5-ethynylphenyl)methyl 3-(N-(4-bromophenyl)sulfonyl-3,5-dimethylanilino)propanoate |
| SMILES | C#Cc1cc(Br)cc(COC(=O)CCN(c2cc(C)cc(C)c2)S(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C26H23Br2NO4S/c1-4-20-14-21(16-23(28)15-20)17-33-26(30)9-10-29(24-12-18(2)11-19(3)13-24)34(31,32)25-7-5-22(27)6-8-25/h1,5-8,11-16H,9-10,17H2,2-3H3 |
| InChIKey | HNMLIVYGEGFDJL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.35 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|