C24H27N3O5 — CID 166355327
4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenyl]butanamide (PubChem CID 166355327) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenyl]butanamide.
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 166355327 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenyl]butanamide |
| SMILES | CC1(C)NC(=O)N(c2cccc(NC(=O)CCCc3ccc4c(c3)OCCCO4)c2)C1=O |
| InChI | InChI=1S/C24H27N3O5/c1-24(2)22(29)27(23(30)26-24)18-8-4-7-17(15-18)25-21(28)9-3-6-16-10-11-19-20(14-16)32-13-5-12-31-19/h4,7-8,10-11,14-15H,3,5-6,9,12-13H2,1-2H3,(H,25,28)(H,26,30) |
| InChIKey | GEFJDDGPPVZGKB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|