C20H19FN4O5 — CID 166355791
N-(3-fluoro-4-morpholin-4-ylphenyl)-2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenoxy]acetamide (PubChem CID 166355791) has the molecular formula C20H19FN4O5 and a molecular weight of 414.39 g/mol. Its IUPAC name is N-(3-fluoro-4-morpholin-4-ylphenyl)-2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenoxy]acetamide.
| Compound Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 166355791 |
| Molecular Formula | C20H19FN4O5 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(-c2noc(=O)[nH]2)cc1)Nc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C20H19FN4O5/c21-16-11-14(3-6-17(16)25-7-9-28-10-8-25)22-18(26)12-29-15-4-1-13(2-5-15)19-23-20(27)30-24-19/h1-6,11H,7-10,12H2,(H,22,26)(H,23,24,27) |
| InChIKey | RCSGBBPREKZGNH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|