C13H13BrN2O3S — CID 166357842
methyl 4-[[(5-bromo-6-methoxy-2-pyridinyl)amino]methyl]thiophene-2-carboxylate (PubChem CID 166357842) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is methyl 4-[[(5-bromo-6-methoxy-2-pyridinyl)amino]methyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-[[(5-bromo-6-methoxy-2-pyridinyl)amino]methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 166357842 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | methyl 4-[[(5-bromo-6-methoxy-2-pyridinyl)amino]methyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(CNc2ccc(Br)c(OC)n2)cs1 |
| InChI | InChI=1S/C13H13BrN2O3S/c1-18-12-9(14)3-4-11(16-12)15-6-8-5-10(20-7-8)13(17)19-2/h3-5,7H,6H2,1-2H3,(H,15,16) |
| InChIKey | LAYVSDGENMJDHP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |