C19H18N2O2S — CID 166360166
[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl 3-pyridin-4-ylpropanoate (PubChem CID 166360166) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl 3-pyridin-4-ylpropanoate.
| Compound Name | [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl 3-pyridin-4-ylpropanoate |
|---|---|
| PubChem CID | 166360166 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl 3-pyridin-4-ylpropanoate |
| SMILES | Cc1ncsc1-c1ccc(COC(=O)CCc2ccncc2)cc1 |
| InChI | InChI=1S/C19H18N2O2S/c1-14-19(24-13-21-14)17-5-2-16(3-6-17)12-23-18(22)7-4-15-8-10-20-11-9-15/h2-3,5-6,8-11,13H,4,7,12H2,1H3 |
| InChIKey | ZEECHRJQALMJHJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |