C17H15F3N4O2 — CID 166361359
N-[5-(2-aminoethyl)-2-hydroxyphenyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridine-8-carboxamide (PubChem CID 166361359) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is N-[5-(2-aminoethyl)-2-hydroxyphenyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridine-8-carboxamide.
| Compound Name | N-[5-(2-aminoethyl)-2-hydroxyphenyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 166361359 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[5-(2-aminoethyl)-2-hydroxyphenyl]-2-(trifluoromethyl)imidazo[1,2-a]pyridine-8-carboxamide |
| SMILES | NCCc1ccc(O)c(NC(=O)c2cccn3cc(C(F)(F)F)nc23)c1 |
| InChI | InChI=1S/C17H15F3N4O2/c18-17(19,20)14-9-24-7-1-2-11(15(24)23-14)16(26)22-12-8-10(5-6-21)3-4-13(12)25/h1-4,7-9,25H,5-6,21H2,(H,22,26) |
| InChIKey | ZQAVTXDRJQYBLJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|