C9H12N2O2S — CID 143055389
[5-(2-aminoethyl)-2-hydroxyphenyl]carbamothioic S-acid (PubChem CID 143055389) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is [5-(2-aminoethyl)-2-hydroxyphenyl]carbamothioic S-acid.
| Compound Name | [5-(2-aminoethyl)-2-hydroxyphenyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 143055389 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | [5-(2-aminoethyl)-2-hydroxyphenyl]carbamothioic S-acid |
| SMILES | NCCc1ccc(O)c(NC(=O)S)c1 |
| InChI | InChI=1S/C9H12N2O2S/c10-4-3-6-1-2-8(12)7(5-6)11-9(13)14/h1-2,5,12H,3-4,10H2,(H2,11,13,14) |
| InChIKey | UIWFLTOAXWMHNO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|