C21H23FN6 — CID 166364325
N-[3-(4-ethylpiperazin-1-yl)phenyl]-2-(5-fluoro-2-pyridinyl)pyrimidin-4-amine (PubChem CID 166364325) has the molecular formula C21H23FN6 and a molecular weight of 378.46 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)phenyl]-2-(5-fluoro-2-pyridinyl)pyrimidin-4-amine.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)phenyl]-2-(5-fluoro-2-pyridinyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 166364325 |
| Molecular Formula | C21H23FN6 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)phenyl]-2-(5-fluoro-2-pyridinyl)pyrimidin-4-amine |
| SMILES | CCN1CCN(c2cccc(Nc3ccnc(-c4ccc(F)cn4)n3)c2)CC1 |
| InChI | InChI=1S/C21H23FN6/c1-2-27-10-12-28(13-11-27)18-5-3-4-17(14-18)25-20-8-9-23-21(26-20)19-7-6-16(22)15-24-19/h3-9,14-15H,2,10-13H2,1H3,(H,23,25,26) |
| InChIKey | XLIJUKBTBNJRMA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |