C17H17IN2O4S — CID 166365056
N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-[(4-iodophenyl)sulfonylamino]acetamide (PubChem CID 166365056) has the molecular formula C17H17IN2O4S and a molecular weight of 472.30 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-[(4-iodophenyl)sulfonylamino]acetamide.
| Compound Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-[(4-iodophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 166365056 |
| Molecular Formula | C17H17IN2O4S |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-[(4-iodophenyl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(I)cc1)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C17H17IN2O4S/c18-12-5-7-13(8-6-12)25(23,24)19-10-16(22)20-17-14-4-2-1-3-11(14)9-15(17)21/h1-8,15,17,19,21H,9-10H2,(H,20,22)/t15-,17+/m1/s1 |
| InChIKey | VUDXAMROKYJIMC-WBVHZDCISA-N |
| XLogP | 1.34 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|