C17H12F2N2O2S — CID 166365803
2-(difluoromethylsulfanyl)-N-(5-phenyl-1,3-oxazol-2-yl)benzamide (PubChem CID 166365803) has the molecular formula C17H12F2N2O2S and a molecular weight of 346.36 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-(5-phenyl-1,3-oxazol-2-yl)benzamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-(5-phenyl-1,3-oxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 166365803 |
| Molecular Formula | C17H12F2N2O2S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-(5-phenyl-1,3-oxazol-2-yl)benzamide |
| SMILES | O=C(Nc1ncc(-c2ccccc2)o1)c1ccccc1SC(F)F |
| InChI | InChI=1S/C17H12F2N2O2S/c18-16(19)24-14-9-5-4-8-12(14)15(22)21-17-20-10-13(23-17)11-6-2-1-3-7-11/h1-10,16H,(H,20,21,22) |
| InChIKey | AWNHRIRDFPZDIM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |